N-(4-methylphenyl)-N-trimethylsilylacetamide structure
|
Common Name | N-(4-methylphenyl)-N-trimethylsilylacetamide | ||
|---|---|---|---|---|
| CAS Number | 10416-79-2 | Molecular Weight | 221.37100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-methylphenyl)-N-trimethylsilylacetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H19NOSi |
|---|---|
| Molecular Weight | 221.37100 |
| Exact Mass | 221.12400 |
| PSA | 20.31000 |
| LogP | 3.18280 |
| InChIKey | IAFRANOIEVHKQV-UHFFFAOYSA-N |
| SMILES | CC(=O)N(c1ccc(C)cc1)[Si](C)(C)C |
|
~%
N-(4-methylphen... CAS#:10416-79-2 |
| Literature: Klebe,J.F. et al. Journal of the American Chemical Society, 1966 , vol. 88, p. 3390 - 3395 |
|
~%
N-(4-methylphen... CAS#:10416-79-2 |
| Literature: Kita,Y. et al. Tetrahedron Letters, 1979 , p. 4311 - 4314 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Trimethylsilylderivat von p-Methylacetanilid |
| N-Acetyl-N-trimethylsilyl-p-toluidin |
| N-Trimethylsilyl-p-methylacetanilid |
| p-Methyl-trimethylsilyl-acetanilid |