9-methoxy-9b-(methoxymethyl)-3,3a,6,6a,9a,9b-hexahydrobenzo[de]chromene-2,7-dione structure
|
Common Name | 9-methoxy-9b-(methoxymethyl)-3,3a,6,6a,9a,9b-hexahydrobenzo[de]chromene-2,7-dione | ||
|---|---|---|---|---|
| CAS Number | 104199-23-7 | Molecular Weight | 278.30000 | |
| Density | 1.25g/cm3 | Boiling Point | 471.4ºC at 760 mmHg | |
| Molecular Formula | C15H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.7ºC | |
| Name | 9-methoxy-9b-(methoxymethyl)-3,3a,6,6a,9a,9b-hexahydrobenzo[de]chromene-2,7-dione |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 471.4ºC at 760 mmHg |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30000 |
| Flash Point | 274.7ºC |
| Exact Mass | 278.11500 |
| PSA | 61.83000 |
| LogP | 1.24000 |
| Vapour Pressure | 4.67E-09mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | NLNLJUJHGJDQKK-UHFFFAOYSA-N |
| SMILES | COCC12C3C=CCC1C(=O)C=C(OC)C2OC(=O)C3 |
|
~%
9-methoxy-9b-(m... CAS#:104199-23-7 |
| Literature: Stevens, Robert V.; Angle, Steven R.; Kloc, Ken; Mak, Kok F.; Trueblood, Kenneth N.; Liu, You-Xi Journal of Organic Chemistry, 1986 , vol. 51, # 23 p. 4347 - 4353 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |