2,3-Diazabicyclo[2.2.1]hept-5-ene,2,3-dibenzoyl- (7CI,8CI,9CI) structure
|
Common Name | 2,3-Diazabicyclo[2.2.1]hept-5-ene,2,3-dibenzoyl- (7CI,8CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 1042-91-7 | Molecular Weight | 304.34300 | |
| Density | 1.296g/cm3 | Boiling Point | 450.4ºC at 760 mmHg | |
| Molecular Formula | C19H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | (3-benzoyl-2,3-diazabicyclo[2.2.1]hept-5-en-2-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 450.4ºC at 760 mmHg |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.34300 |
| Flash Point | 197.9ºC |
| Exact Mass | 304.12100 |
| PSA | 40.62000 |
| LogP | 2.77270 |
| Vapour Pressure | 2.65E-08mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | OADDZCQHRNUEJA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)N1C2C=CC(C2)N1C(=O)c1ccccc1 |
|
~99%
2,3-Diazabicycl... CAS#:1042-91-7 |
| Literature: Arakawa, Yasushi; Goto, Takahiro; Kawase, Kazuya; Yoshifuji, Shigeyuki Chemical and Pharmaceutical Bulletin, 1998 , vol. 46, # 4 p. 674 - 680 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3-dibenzoyl-2,3-diaza-bicyclo[2.2.1]hept-5-ene |