3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one
3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one structure
|
Common Name | 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one | ||
|---|---|---|---|---|
| CAS Number | 10429-07-9 | Molecular Weight | 274.441 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 368.5±10.0 °C at 760 mmHg | |
| Molecular Formula | C26H36O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.7±11.3 °C | |
Summary: 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one (CAS number: 10429-07-9), molecular formula: C26H36O4S, molecular weight: 274.441. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 368.5±10.0 °C at 760 mmHg |
| Molecular Formula | C26H36O4S |
| Molecular Weight | 274.441 |
| Flash Point | 168.7±11.3 °C |
| Exact Mass | 274.229675 |
| PSA | 68.82000 |
| LogP | 5.80 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | HNTMKSKJRZRWKS-MWLOVLLCSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC3(C)C(CCC4C5CCC(=O)C5(C)CCC43)C2)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 7 | |
CAS#:14639-79-3
CAS#:1156-86-1![(5S,8R,9S,10S,13S,14S)-10,13-dimethyl-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one structure](https://image.chemsrc.com/caspic/321/14935-81-0.png)
CAS#:14935-81-0
CAS#:7680-12-8
CAS#:53-41-8
CAS#:846-46-8
CAS#:10429-04-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3β-p-tolylsulphonyloxy-5α-androstan-17-one |
| Androstan-17-one |
| 3β-(Toluol-4-sulfonyloxy)-5α-androstan-17-on |
| 3β-tosyloxy-5α-androstan-17-one |
| 3β-(toluene-4-sulfonyloxy)-5α-androstan-17-one |
| 3β-(tosyloxy)-5αH-androstan-17-one |
| 3β-hydroxyandrostan-17-one p-tosylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one? |
| A: LogP of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one is 5.80. |
| Q: What is the molecular formula of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one? |
| A: Molecular formula of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one is C26H36O4S. |
| Q: What English synonyms does 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one have? |
| A: English synonyms of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one: 3β-p-tolylsulphonyloxy-5α-androstan-17-one, Androstan-17-one, 3β-(Toluol-4-sulfonyloxy)-5α-androstan-17-on, 3β-tosyloxy-5α-androstan-17-one, 3β-(toluene-4-sulfonyloxy)-5α-androstan-17-one, 3β-(tosyloxy)-5αH-androstan-17-one, 3β-hydroxyandrostan-17-one p-tosylate. |
| Q: What is the Chinese name of 10429-07-9? |
| A: Chinese name of 10429-07-9 is 10429-07-9. |
| Q: What is the molecular weight of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one? |
| A: Molecular weight of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one is 274.441. |
| Q: What is the CAS number of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one? |
| A: CAS number of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one is 10429-07-9. |
| Q: What is the InChIKey of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one? |
| A: InChIKey of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one is HNTMKSKJRZRWKS-MWLOVLLCSA-N. |
| Q: What is the English name of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one? |
| A: The English name of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one is 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one. |
| Q: What are the downstream products of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one? |
| A: Related downstream products(CAS) of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one: 14639-79-3;1156-86-1;14935-81-0;7680-12-8;53-41-8;846-46-8;10429-04-6. |
| Q: What is the boiling point of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one? |
| A: Boiling point of 3β-(4-methylphenylsulfonyloxy)-5α-androstan-17-one is 368.5±10.0 °C at 760 mmHg. |