Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate
Modify Date: 2026-07-03 23:15:44
![Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate Structure](https://www.chemsrc.com/extcaspic/327/1042989-53-6.png)
Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate structure
|
Common Name | Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate | ||
|---|---|---|---|---|
| CAS Number | 1042989-53-6 | Molecular Weight | 232.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13O5P |
|---|---|
| Molecular Weight | 232.17 |
| InChIKey | HLQGMCUMJUGRPK-UHFFFAOYSA-N |
| SMILES | COP(=O)(CC(=O)c1ccoc1C)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1042989-53-6? |
| A: Chinese name of 1042989-53-6 is 1042989-53-6. |
| Q: What is the CAS number of Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate? |
| A: CAS number of Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate is 1042989-53-6. |
| Q: What is the SMILES notation of Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate? |
| A: SMILES notation of Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate is COP(=O)(CC(=O)c1ccoc1C)OC. |
| Q: What is the molecular formula of Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate? |
| A: Molecular formula of Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate is C9H13O5P. |
| Q: What is the InChIKey of Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate? |
| A: InChIKey of Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate is HLQGMCUMJUGRPK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate? |
| A: Molecular weight of Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate is 232.17. |
| Q: What is the English name of Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate? |
| A: The English name of Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate is Dimethyl [2-(2-methylfuran-3-yl)-2-oxoethyl]phosphonate. |