Benzamide,4-[(2,3-dihydro-2-hydroxy-1H-inden-1-yl)amino]-N-(1-methylethyl)- structure
|
Common Name | Benzamide,4-[(2,3-dihydro-2-hydroxy-1H-inden-1-yl)amino]-N-(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 1043-86-3 | Molecular Weight | 310.39000 | |
| Density | 1.221g/cm3 | Boiling Point | 549ºC at 760 mmHg | |
| Molecular Formula | C19H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.8ºC | |
| Name | 4-((2-hydroxy-2,3-dihydro-1H-inden-1-yl)amino)-N-isopropylbenzamide |
|---|
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 549ºC at 760 mmHg |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.39000 |
| Flash Point | 285.8ºC |
| Exact Mass | 310.16800 |
| PSA | 61.36000 |
| LogP | 3.35890 |
| Vapour Pressure | 6.94E-13mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | JILKSOJTLVKGOK-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)c1ccc(NC2c3ccccc3CC2O)cc1 |
|
~%
Benzamide,4-[(2... CAS#:1043-86-3 |
| Literature: Sam,J.; Snapp,T.C. Journal of Pharmaceutical Sciences, 1964 , vol. 53, p. 1364 - 1367 |
|
~%
Benzamide,4-[(2... CAS#:1043-86-3 |
| Literature: Sam,J.; Snapp,T.C. Journal of Pharmaceutical Sciences, 1964 , vol. 53, p. 1364 - 1367 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |