1,1,2,2-Cyclopropanetetracarbonitrile,3-methyl-3-(4-methylphenyl)- structure
|
Common Name | 1,1,2,2-Cyclopropanetetracarbonitrile,3-methyl-3-(4-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 10432-49-2 | Molecular Weight | 246.26700 | |
| Density | 1.26g/cm3 | Boiling Point | 556.2ºC at 760 mmHg | |
| Molecular Formula | C15H10N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.6ºC | |
| Name | 3-methyl-3-(4-methylphenyl)cyclopropane-1,1,2,2-tetracarbonitrile |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 556.2ºC at 760 mmHg |
| Molecular Formula | C15H10N4 |
| Molecular Weight | 246.26700 |
| Flash Point | 283.6ºC |
| Exact Mass | 246.09100 |
| PSA | 95.16000 |
| LogP | 2.33342 |
| Vapour Pressure | 2.08E-12mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | VPNPDIWDHJWNFS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2(C)C(C#N)(C#N)C2(C#N)C#N)cc1 |
|
~%
1,1,2,2-Cyclopr... CAS#:10432-49-2 |
| Literature: Hart,H.; Kim,Y.C. Journal of Organic Chemistry, 1966 , vol. 31, p. 2784 - 2789 |
|
~%
1,1,2,2-Cyclopr... CAS#:10432-49-2 |
| Literature: Hart,H.; Kim,Y.C. Journal of Organic Chemistry, 1966 , vol. 31, p. 2784 - 2789 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |