2-((4-Methylbenzyl)thio)benzoic acid structure
|
Common Name | 2-((4-Methylbenzyl)thio)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 104351-51-1 | Molecular Weight | 258.336 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 419.5±38.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O2S | Melting Point | 183-187ºC | |
| MSDS | N/A | Flash Point | 207.5±26.8 °C | |
| Name | 2-((4-Methylbenzyl)thio)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.5±38.0 °C at 760 mmHg |
| Melting Point | 183-187ºC |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.336 |
| Flash Point | 207.5±26.8 °C |
| Exact Mass | 258.071442 |
| PSA | 62.60000 |
| LogP | 4.13 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | KHKYMBMPMKQXCP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CSc2ccccc2C(=O)O)cc1 |
| HS Code | 2930909090 |
|---|
|
~88%
2-((4-Methylben... CAS#:104351-51-1 |
| Literature: Porter, Brianne L.; McClure, Beth Anne; Abrams, Eric R.; Engle, James T.; Ziegler, Christopher J.; Rack, Jeffrey J. Journal of Photochemistry and Photobiology A: Chemistry, 2011 , vol. 217, # 2-3 p. 341 - 346 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[(4-methylbenzyl)thio]benzoic acid |
| 2-[(4-Methylbenzyl)sulfanyl]benzoic acid |
| 2-[(4-methylphenyl)methylsulfanyl]benzoic acid |
| Benzoic acid, 2-[[(4-methylphenyl)methyl]thio]- |
| Benzoicacid,2-[[(4-methylphenyl)methyl]thio]- |