Prizidilol, (S)
Modify Date: 2025-09-02 09:26:59
Prizidilol, (S) structure
|
Common Name | Prizidilol, (S) | ||
|---|---|---|---|---|
| CAS Number | 104372-94-3 | Molecular Weight | 331.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Prizidilol, (S) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H25N5O2 |
|---|---|
| Molecular Weight | 331.4 |
| InChIKey | QGONODUKOFNSOY-LBPRGKRZSA-N |
| SMILES | CC(C)(C)NCC(O)COc1ccccc1-c1ccc(NN)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Prizidilol, (S)? |
| A: The English name of Prizidilol, (S) is Prizidilol, (S). |
| Q: What is the SMILES notation of Prizidilol, (S)? |
| A: SMILES notation of Prizidilol, (S) is CC(C)(C)NCC(O)COc1ccccc1-c1ccc(NN)nn1. |
| Q: What is the Chinese name of 104372-94-3? |
| A: Chinese name of 104372-94-3 is 104372-94-3. |
| Q: What is the molecular formula of Prizidilol, (S)? |
| A: Molecular formula of Prizidilol, (S) is C17H25N5O2. |
| Q: What is the CAS number of Prizidilol, (S)? |
| A: CAS number of Prizidilol, (S) is 104372-94-3. |
| Q: What is the molecular weight of Prizidilol, (S)? |
| A: Molecular weight of Prizidilol, (S) is 331.4. |
| Q: What is the InChIKey of Prizidilol, (S)? |
| A: InChIKey of Prizidilol, (S) is QGONODUKOFNSOY-LBPRGKRZSA-N. |