isopropyl-diiodothyronine structure
|
Common Name | isopropyl-diiodothyronine | ||
|---|---|---|---|---|
| CAS Number | 10439-94-8 | Molecular Weight | 567.15700 | |
| Density | 1.908g/cm3 | Boiling Point | 585.8ºC at 760mmHg | |
| Molecular Formula | C18H19I2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.1ºC | |
| Name | (2R)-2-(diiodoamino)-2-[[4-(4-hydroxyphenoxy)phenyl]methyl]-3-methylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.908g/cm3 |
|---|---|
| Boiling Point | 585.8ºC at 760mmHg |
| Molecular Formula | C18H19I2NO4 |
| Molecular Weight | 567.15700 |
| Flash Point | 308.1ºC |
| Exact Mass | 566.94000 |
| PSA | 70.00000 |
| LogP | 5.20840 |
| Vapour Pressure | 1.44E-14mmHg at 25°C |
| Index of Refraction | 1.691 |
| InChIKey | GJNQSKLKJVPWIR-GOSISDBHSA-N |
| SMILES | CC(C)C(Cc1ccc(Oc2ccc(O)cc2)cc1)(C(=O)O)N(I)I |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-Isopropyl-3,5-diiodothyronine |
| 3'-Isopropyl-3,5-diiodo-L-thyrosine |
| 3'-Isopropyl-3,5-diiodthyronin |
| DL-3,5-Diiod-3'-isopropyl-thyronin |
| 3,5-Diiodo-3'-isopropyl-L-thyronine |
| Isopropyl-diiodothyronine |
| IPDIT |