Glafenic Acid-d4 structure
|
Common Name | Glafenic Acid-d4 | ||
|---|---|---|---|---|
| CAS Number | 10440-42-3 | Molecular Weight | 298.72400 | |
| Density | 1.441g/cm3 | Boiling Point | 486.8ºC at 760 mmHg | |
| Molecular Formula | C16H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.2ºC | |
| Name | Glafenic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.441g/cm3 |
|---|---|
| Boiling Point | 486.8ºC at 760 mmHg |
| Molecular Formula | C16H11ClN2O2 |
| Molecular Weight | 298.72400 |
| Flash Point | 248.2ºC |
| Exact Mass | 298.05100 |
| PSA | 62.22000 |
| LogP | 4.40300 |
| Vapour Pressure | 2.74E-10mmHg at 25°C |
| Index of Refraction | 1.737 |
| InChIKey | HTKGKUISLUERQX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1ccnc2cc(Cl)ccc12 |
| Storage condition | -20°C |
| HS Code | 2933499090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[(7-chloroquinolin-4-yl)amino]benzoic acid |