1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester
Modify Date: 2025-10-23 11:54:15
![1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester Structure](https://www.chemsrc.com/extcaspic/074/104408-91-5.png)
1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester structure
|
Common Name | 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 104408-91-5 | Molecular Weight | 298.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H26N2O4 |
|---|---|
| Molecular Weight | 298.38 |
| InChIKey | FELYBXYCKREDEQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CCOC(=O)N1C(C(=O)O)CC2CCNCC21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester? |
| A: The English name of 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester is 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester. |
| Q: What is the SMILES notation of 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester? |
| A: SMILES notation of 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester is CC(C)(C)CCOC(=O)N1C(C(=O)O)CC2CCNCC21. |
| Q: What is the CAS number of 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester? |
| A: CAS number of 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester is 104408-91-5. |
| Q: What is the molecular weight of 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester? |
| A: Molecular weight of 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester is 298.38. |
| Q: What is the molecular formula of 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester? |
| A: Molecular formula of 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester is C15H26N2O4. |
| Q: What is the InChIKey of 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester? |
| A: InChIKey of 1h-Pyrrolo[2,3-c]pyridine-1,2-dicarboxylic acid,octahydro-,1-(1,1-dimethylethyl)2-ethyl ester is FELYBXYCKREDEQ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 104408-91-5? |
| A: Chinese name of 104408-91-5 is 104408-91-5. |