[1,1'-Biphenyl]-2-ol,2-(N-methylcarbamate) structure
|
Common Name | [1,1'-Biphenyl]-2-ol,2-(N-methylcarbamate) | ||
|---|---|---|---|---|
| CAS Number | 10441-15-3 | Molecular Weight | 227.25900 | |
| Density | 1.129g/cm3 | Boiling Point | 359.3ºC at 760 mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.1ºC | |
| Name | (2-phenylphenyl) N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 359.3ºC at 760 mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 171.1ºC |
| Exact Mass | 227.09500 |
| PSA | 38.33000 |
| LogP | 3.46270 |
| Vapour Pressure | 2.41E-05mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | NAGVBMFPWUUBBG-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1ccccc1-c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Phenyl-phenyl-N-methylcarbamat |
| biphenyl-2-yl methylcarbamate |