5-[4-(1-Methylethoxy)phenyl]-2-pyridinamine structure
|
Common Name | 5-[4-(1-Methylethoxy)phenyl]-2-pyridinamine | ||
|---|---|---|---|---|
| CAS Number | 1044239-22-6 | Molecular Weight | 228.29000 | |
| Density | 1.099 | Boiling Point | 377.856ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.321ºC | |
| Name | 5-(4-propan-2-yloxyphenyl)pyridin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.099 |
|---|---|
| Boiling Point | 377.856ºC at 760 mmHg |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29000 |
| Flash Point | 182.321ºC |
| Exact Mass | 228.12600 |
| PSA | 48.87000 |
| LogP | 3.04810 |
| InChIKey | NERWKAIDFSZAEX-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1ccc(-c2ccc(N)nc2)cc1 |
| HS Code | 2933399090 |
|---|
|
~63%
5-[4-(1-Methyle... CAS#:1044239-22-6 |
| Literature: Heitman, Laura H.; Van Veldhoven, Jacobus P. D.; Zweemer, Annelien M.; Ye, Kai; Brussee, Johannes; Ijzerrnan, Adriaan P. Journal of Medicinal Chemistry, 2008 , vol. 51, # 15 p. 4724 - 4729 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-[4-(ISOPROPOXY)PHENYL]-2-PYRIDINAMINE |
| QC-5444 |
| 5-(4-isopropoxyphenyl)pyridin-2-amine |
| 5-(4-isopropoxyphenyl)pyridin-2-ylamine |