diethyl 2-(2-cyanoethyl)-2-ethylpropanedioate structure
|
Common Name | diethyl 2-(2-cyanoethyl)-2-ethylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 10444-12-9 | Molecular Weight | 241.28400 | |
| Density | 1.062g/cm3 | Boiling Point | 347.5ºC at 760 mmHg | |
| Molecular Formula | C12H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.7ºC | |
| Name | diethyl 2-(2-cyanoethyl)-2-ethylpropanedioate |
|---|
| Density | 1.062g/cm3 |
|---|---|
| Boiling Point | 347.5ºC at 760 mmHg |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.28400 |
| Flash Point | 151.7ºC |
| Exact Mass | 241.13100 |
| PSA | 76.39000 |
| LogP | 1.81278 |
| Vapour Pressure | 5.37E-05mmHg at 25°C |
| Index of Refraction | 1.45 |
| InChIKey | GSWKMAHBAVRRAK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC)(CCC#N)C(=O)OCC |
|
~96%
diethyl 2-(2-cy... CAS#:10444-12-9 |
| Literature: European Journal of Organic Chemistry, , vol. 2014, # 15 p. 3109 - 3115 |