Benzenamine,N,N-bis(2-chloroethyl)-4-[[(4-chlorophenyl)imino]methyl]- structure
|
Common Name | Benzenamine,N,N-bis(2-chloroethyl)-4-[[(4-chlorophenyl)imino]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 10444-44-7 | Molecular Weight | 355.68900 | |
| Density | 1.21g/cm3 | Boiling Point | 497.5ºC at 760mmHg | |
| Molecular Formula | C17H17Cl3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.7ºC | |
| Name | N,N-bis(2-chloroethyl)-4-[(4-chlorophenyl)iminomethyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 497.5ºC at 760mmHg |
| Molecular Formula | C17H17Cl3N2 |
| Molecular Weight | 355.68900 |
| Flash Point | 254.7ºC |
| Exact Mass | 354.04600 |
| PSA | 15.60000 |
| LogP | 5.37460 |
| Vapour Pressure | 4.93E-10mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | JLMIBYJDXDOZOU-UHFFFAOYSA-N |
| SMILES | ClCCN(CCCl)c1ccc(C=Nc2ccc(Cl)cc2)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| n,n-bis(2-chloroethyl)-4-{(e)-[(4-chlorophenyl)imino]methyl}aniline |
| 4-[Bis-(2-chloraethyl)amino]-benzyliden-p-chloranilin |