CAY10491 structure
|
Common Name | CAY10491 | ||
|---|---|---|---|---|
| CAS Number | 1044764-12-6 | Molecular Weight | 391.506 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 561.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H29N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.4±30.1 °C | |
| Name | tert-butyl 4-[[4-(1H-indol-4-yl)piperazin-1-yl]methyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 561.6±50.0 °C at 760 mmHg |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.506 |
| Flash Point | 293.4±30.1 °C |
| Exact Mass | 391.225983 |
| PSA | 48.57000 |
| LogP | 4.43 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | WVPYSZULKPMZLZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1ccc(CN2CCN(c3cccc4[nH]ccc34)CC2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzoic acid, 4-[[4-(1H-indol-4-yl)-1-piperazinyl]methyl]-, 1,1-dimethylethyl ester |
| tert-butyl 4-{[4-(1H-indol-4-yl)piperazin-1-yl]methyl}benzoate |
| 2-Methyl-2-propanyl 4-{[4-(1H-indol-4-yl)-1-piperazinyl]methyl}benzoate |