6-ethyl-5-(3-nitro-4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine structure
|
Common Name | 6-ethyl-5-(3-nitro-4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 104484-42-6 | Molecular Weight | 342.39600 | |
| Density | 1.303g/cm3 | Boiling Point | 624.4ºC at 760 mmHg | |
| Molecular Formula | C17H22N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.4ºC | |
| Name | 6-ethyl-5-(3-nitro-4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine |
|---|
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 624.4ºC at 760 mmHg |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.39600 |
| Flash Point | 331.4ºC |
| Exact Mass | 342.18000 |
| PSA | 128.34000 |
| LogP | 3.21730 |
| Vapour Pressure | 1.65E-15mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | SGWVNXVUSVARKJ-UHFFFAOYSA-N |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
|
~91%
6-ethyl-5-(3-ni... CAS#:104484-42-6 |
| Literature: Griffin, Roger J.; Meek, Michelle A.; Schwalbe, Carl H.; Stevens, Malcolm F. G. Journal of Medicinal Chemistry, 1989 , vol. 32, # 11 p. 2468 - 2474 |
|
~%
6-ethyl-5-(3-ni... CAS#:104484-42-6 |
| Literature: Griffin, Roger J.; Schwalbe, Carl H.; Stevens, Malcolm F. G.; Wong, Kait P. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 2267 - 2276 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |