1-Cyclohexyl-3-phenyl-5-(2-propenyl)barbituric acid structure
|
Common Name | 1-Cyclohexyl-3-phenyl-5-(2-propenyl)barbituric acid | ||
|---|---|---|---|---|
| CAS Number | 1045-97-2 | Molecular Weight | 326.39000 | |
| Density | 1.202g/cm3 | Boiling Point | 445.2ºC at 760 mmHg | |
| Molecular Formula | C19H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184ºC | |
| Name | 1-cyclohexyl-3-phenyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 445.2ºC at 760 mmHg |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.39000 |
| Flash Point | 184ºC |
| Exact Mass | 326.16300 |
| PSA | 57.69000 |
| LogP | 3.50970 |
| Vapour Pressure | 4.02E-08mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | KUOBVCZIZVOJEJ-UHFFFAOYSA-N |
| SMILES | C=CCC1C(=O)N(c2ccccc2)C(=O)N(C2CCCCC2)C1=O |
| HS Code | 2933540000 |
|---|
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1-Phenyl-3-cyclohexyl-5-allyl-barbitursaeure |
| 5-allyl-1-cyclohexyl-3-phenyl-pyrimidine-2,4,6-trione |
| 5-Allyl-1-cyclohexyl-3-phenylbarbituric acid |
| BARBITURIC ACID,5-ALLYL-1-CYCLOHEXYL-3-PHENYL |