2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-benzothiazole structure
|
Common Name | 2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-benzothiazole | ||
|---|---|---|---|---|
| CAS Number | 104519-26-8 | Molecular Weight | 285.40700 | |
| Density | 1.2g/cm3 | Boiling Point | 448.6ºC at 760mmHg | |
| Molecular Formula | C16H19N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | 2-(4-butyl-3,5-dimethylpyrazol-1-yl)-1,3-benzothiazole |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 448.6ºC at 760mmHg |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.40700 |
| Flash Point | 225.1ºC |
| Exact Mass | 285.13000 |
| PSA | 58.95000 |
| LogP | 4.44140 |
| Vapour Pressure | 3.07E-08mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | HIIFETMIXDYLEK-UHFFFAOYSA-N |
| SMILES | CCCCc1c(C)nn(-c2nc3ccccc3s2)c1C |
|
~62%
2-(4-butyl-3,5-... CAS#:104519-26-8 |
| Literature: Singh, S. P.; Vaid, R. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 288 - 291 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |