2-(2-cyclohexyl-1-nitroethyl)sulfanylpyridine structure
|
Common Name | 2-(2-cyclohexyl-1-nitroethyl)sulfanylpyridine | ||
|---|---|---|---|---|
| CAS Number | 104543-10-4 | Molecular Weight | 266.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-cyclohexyl-1-nitroethyl)sulfanylpyridine |
|---|
| Molecular Formula | C13H18N2O2S |
|---|---|
| Molecular Weight | 266.35900 |
| Exact Mass | 266.10900 |
| PSA | 84.01000 |
| LogP | 4.27010 |
| InChIKey | VOMNVPJVWMEHFP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(CC1CCCCC1)Sc1ccccn1 |
|
~67%
2-(2-cyclohexyl... CAS#:104543-10-4 |
| Literature: Barton, Derek H.R.; Togo, Hideo; Zard, Samir Z. Tetrahedron, 1985 , vol. 41, # 23 p. 5507 - 5516 |
|
~%
2-(2-cyclohexyl... CAS#:104543-10-4 |
| Literature: Barton, Derek H.R.; Crich, David; Kretzschmar, Gerhard Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1986 , p. 39 - 54 |