N-[2-[(2,2,5,5-tetramethyl-1H-pyrrole-3-carbonyl)amino]ethyl]pyridine-2-carboxamide,dihydrochloride structure
|
Common Name | N-[2-[(2,2,5,5-tetramethyl-1H-pyrrole-3-carbonyl)amino]ethyl]pyridine-2-carboxamide,dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 104545-48-4 | Molecular Weight | 389.32000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26Cl2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-[(2,2,5,5-tetramethyl-1H-pyrrole-3-carbonyl)amino]ethyl]pyridine-2-carboxamide,dihydrochloride |
|---|
| Molecular Formula | C17H26Cl2N4O2 |
|---|---|
| Molecular Weight | 389.32000 |
| Exact Mass | 388.14300 |
| PSA | 90.10000 |
| LogP | 4.36230 |
| InChIKey | LEUSTRSSMZAYJS-UHFFFAOYSA-N |
| SMILES | CC1(C)C=C(C(=O)NCCNC(=O)c2ccccn2)C(C)(C)N1.Cl.Cl |
|
~71%
N-[2-[(2,2,5,5-... CAS#:104545-48-4 |
| Literature: Hankovszky; Hideg; Bodi; Frank Journal of Medicinal Chemistry, 1986 , vol. 29, # 7 p. 1138 - 1152 |
|
~%
N-[2-[(2,2,5,5-... CAS#:104545-48-4 |
| Literature: Hankovszky; Hideg; Bodi; Frank Journal of Medicinal Chemistry, 1986 , vol. 29, # 7 p. 1138 - 1152 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |