3-[phenyl(piperidin-1-yl)methyl]pentane-2,4-dione structure
|
Common Name | 3-[phenyl(piperidin-1-yl)methyl]pentane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 104549-51-1 | Molecular Weight | 273.37000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[phenyl(piperidin-1-yl)methyl]pentane-2,4-dione |
|---|
| Molecular Formula | C17H23NO2 |
|---|---|
| Molecular Weight | 273.37000 |
| Exact Mass | 273.17300 |
| PSA | 37.38000 |
| LogP | 2.94570 |
| InChIKey | QWPPREODZKCLLA-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(C)=O)C(c1ccccc1)N1CCCCC1 |
|
~%
3-[phenyl(piper... CAS#:104549-51-1 |
| Literature: Ruhemann; Watson Journal of the Chemical Society, 1904 , vol. 85, p. 1175 |
|
~%
3-[phenyl(piper... CAS#:104549-51-1 |
| Literature: Dilthey; Steinborn Journal fuer Praktische Chemie (Leipzig), 1932 , vol. <2>, # 133 p. 219,255 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |