4H-1-Benzopyran-4-one, 2-(3,5-dibromo-4-hydroxyphenyl)-6-hydroxy-3-met hyl- structure
|
Common Name | 4H-1-Benzopyran-4-one, 2-(3,5-dibromo-4-hydroxyphenyl)-6-hydroxy-3-met hyl- | ||
|---|---|---|---|---|
| CAS Number | 104567-72-8 | Molecular Weight | 426.05600 | |
| Density | 1.881g/cm3 | Boiling Point | 529.1ºC at 760 mmHg | |
| Molecular Formula | C16H10Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.8ºC | |
| Name | 2-(3,5-dibromo-4-hydroxyphenyl)-6-hydroxy-3-methylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.881g/cm3 |
|---|---|
| Boiling Point | 529.1ºC at 760 mmHg |
| Molecular Formula | C16H10Br2O4 |
| Molecular Weight | 426.05600 |
| Flash Point | 273.8ºC |
| Exact Mass | 423.89500 |
| PSA | 70.67000 |
| LogP | 4.70460 |
| Vapour Pressure | 8.26E-12mmHg at 25°C |
| Index of Refraction | 1.705 |
| InChIKey | GKDYOXMZSXVKPP-UHFFFAOYSA-N |
| SMILES | Cc1c(-c2cc(Br)c(O)c(Br)c2)oc2ccc(O)cc2c1=O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-Methyl-4',6-dihydroxy-3',5'-dibromoflavone |
| 3',5'-Dibrom-6,4'-dihydroxy-3-methylflavone |
| FL8 |
| 6,4'-DIHYDROXY-3-METHYL-3',5'-DIBROMOFLAVONE |