(2S)-2-amino-5-[(2,4-dinitrophenyl)amino]pentanoic acid
Modify Date: 2025-08-27 10:06:17
![(2S)-2-amino-5-[(2,4-dinitrophenyl)amino]pentanoic acid Structure](https://image.chemsrc.com/caspic/191/10457-27-9.png)
(2S)-2-amino-5-[(2,4-dinitrophenyl)amino]pentanoic acid structure
|
Common Name | (2S)-2-amino-5-[(2,4-dinitrophenyl)amino]pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 10457-27-9 | Molecular Weight | 298.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-amino-5-(2,4-dinitroanilino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14N4O6 |
|---|---|
| Molecular Weight | 298.25200 |
| Exact Mass | 298.09100 |
| PSA | 166.99000 |
| LogP | 2.92670 |
| InChIKey | AYMDNNQPNXWIKK-QMMMGPOBSA-N |
| SMILES | NC(CCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| HS Code | 2922499990 |
|---|
|
~%
(2S)-2-amino-5-... CAS#:10457-27-9 |
| Literature: Sanger Biochemical Journal, 1946 , vol. 40, p. 261 |
|
~%
(2S)-2-amino-5-... CAS#:10457-27-9 |
| Literature: Kawai, Masao; Nagai, Ukon Bulletin of the Chemical Society of Japan, 1982 , vol. 55, # 4 p. 1327 - 1328 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2,4-Dnp-ornithine |
| 2,4-Dinitrophenylornithine |