1H-Imidazole, 4-fluoro-1,2-dimethyl-5-nitro- structure
|
Common Name | 1H-Imidazole, 4-fluoro-1,2-dimethyl-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 104575-32-8 | Molecular Weight | 159.11800 | |
| Density | 1.49g/cm3 | Boiling Point | 331.6ºC at 760mmHg | |
| Molecular Formula | C5H6FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.3ºC | |
| Name | 4-fluoro-1,2-dimethyl-5-nitroimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 331.6ºC at 760mmHg |
| Molecular Formula | C5H6FN3O2 |
| Molecular Weight | 159.11800 |
| Flash Point | 154.3ºC |
| Exact Mass | 159.04400 |
| PSA | 63.64000 |
| LogP | 1.29900 |
| Vapour Pressure | 0.000298mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | GGLVNMBXNKDQBR-UHFFFAOYSA-N |
| SMILES | Cc1nc(F)c([N+](=O)[O-])n1C |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Imidazole,4-fluoro-1,2-dimethyl-5-nitro |
| 1,2-dimethyl-4-fluoro-5-nitroimidazole |
| 4-Fluoro-1,2-dimethyl-5-nitro-1H-imidazole |