Ambrisentan-d10 structure
|
Common Name | Ambrisentan-d10 | ||
|---|---|---|---|---|
| CAS Number | 1046116-27-1 | Molecular Weight | 388.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H12D10N2O4 | Melting Point | >160°C | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ambrisentan-d10Ambrisentan-d10 (BSF 208075-d10; LU 208075-d10) is the deuterium labled Ambrisentan (HY-13209). Ambrisentan is a selective ET type A receptor (ETAR) antagonist. |
| Name | 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-bis(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ambrisentan-d10 (BSF 208075-d10; LU 208075-d10) is the deuterium labled Ambrisentan (HY-13209). Ambrisentan is a selective ET type A receptor (ETAR) antagonist. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | >160°C |
|---|---|
| Molecular Formula | C22H12D10N2O4 |
| Molecular Weight | 388.48 |
| Exact Mass | 388.22100 |
| PSA | 81.54000 |
| LogP | 3.51560 |
| InChIKey | OUJTZYPIHDYQMC-KYBYSFRQSA-N |
| SMILES | COC(c1ccccc1)(c1ccccc1)C(Oc1nc(C)cc(C)n1)C(=O)O |
| Storage condition | -20C |
| Ambrisentan-d10 |