4-Hydroxy-3-iodo-5-nitrobenzoic acid structure
|
Common Name | 4-Hydroxy-3-iodo-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 10463-17-9 | Molecular Weight | 309.01500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4INO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Hydroxy-3-iodo-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4INO5 |
|---|---|
| Molecular Weight | 309.01500 |
| Exact Mass | 308.91300 |
| PSA | 103.35000 |
| LogP | 2.12640 |
| InChIKey | OVNWFZWJHJVRGG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(I)c(O)c([N+](=O)[O-])c1 |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 4-hydroxy-3-iodo-5-nitro-benzoic acid |
| 3-Iodo-4-hydroxy-5-nitrobenzoicacid |
| 4-Hydroxy-3-iod-5-nitrobenzoesaeure |
| Benzoic acid,4-hydroxy-3-iodo-5-nitro |
| 4-Hydroxy-3-jod-5-nitro-benzoesaeure |