1-(3-bromopropyl)-2,3,3-trimethylindol-1-ium,bromide structure
|
Common Name | 1-(3-bromopropyl)-2,3,3-trimethylindol-1-ium,bromide | ||
|---|---|---|---|---|
| CAS Number | 104650-18-2 | Molecular Weight | 361.11500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19Br2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-bromopropyl)-2,3,3-trimethylindol-1-ium,bromide |
|---|
| Molecular Formula | C14H19Br2N |
|---|---|
| Molecular Weight | 361.11500 |
| Exact Mass | 358.98800 |
| PSA | 3.01000 |
| LogP | 0.83050 |
| InChIKey | AURKEWXRIYKJAR-UHFFFAOYSA-M |
| SMILES | CC1=[N+](CCCBr)c2ccccc2C1(C)C.[Br-] |
|
~9%
1-(3-bromopropy... CAS#:104650-18-2 |
| Literature: Andersson, Johanna; Li, Shiming; Lincoln, Per; Andreasson, Joakim Journal of the American Chemical Society, 2008 , vol. 130, # 36 p. 11836 - 11837 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |