2,3-Dihydro-5-furylboronic acid pinacol ester structure
|
Common Name | 2,3-Dihydro-5-furylboronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 1046812-02-5 | Molecular Weight | 196.05100 | |
| Density | 1.018g/mLat 25°C | Boiling Point | 218.8±50.0 °C(Predicted) | |
| Molecular Formula | C10H17BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110°C | |
| Name | 2-(4,5-Dihydrofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.018g/mLat 25°C |
|---|---|
| Boiling Point | 218.8±50.0 °C(Predicted) |
| Molecular Formula | C10H17BO3 |
| Molecular Weight | 196.05100 |
| Flash Point | 110°C |
| Exact Mass | 196.12700 |
| PSA | 27.69000 |
| LogP | 1.92200 |
| InChIKey | QLKFMGAHJYGUES-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(C2=CCCO2)OC1(C)C |
| Storage condition | 2-8°C |
| HS Code | 2934999090 |
|---|
|
~%
2,3-Dihydro-5-f... CAS#:1046812-02-5 |
| Literature: Chemistry Letters, , vol. 37, # 6 p. 664 - 665 |
|
~%
2,3-Dihydro-5-f... CAS#:1046812-02-5 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 81, # 12 p. 1535 - 1553 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2,3-dihydrofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |