1-Methylcyclopropyl 4-nitrophenyl carbonate structure
|
Common Name | 1-Methylcyclopropyl 4-nitrophenyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 1046817-22-4 | Molecular Weight | 237.20900 | |
| Density | 1.35±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H11NO5 | Melting Point | 46-48 ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-methylcyclopropyl) (4-nitrophenyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35±0.1 g/cm3 |
|---|---|
| Melting Point | 46-48 ºC |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.20900 |
| Exact Mass | 237.06400 |
| PSA | 81.35000 |
| LogP | 3.18590 |
| InChIKey | JHDOETPMTMBQTH-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)Oc2ccc([N+](=O)[O-])cc2)CC1 |
| HS Code | 2920909090 |
|---|
|
~85%
1-Methylcyclopr... CAS#:1046817-22-4 |
| Literature: Snider, Erik J.; Wright, Stephen W. Tetrahedron Letters, 2011 , vol. 52, # 25 p. 3171 - 3174 |
|
~%
1-Methylcyclopr... CAS#:1046817-22-4 |
| Literature: Wright, Stephen W.; Darout, Etzer; Stevens, Benjamin D. Synthesis (Germany), 2013 , vol. 45, # 17 art. no. SS-2013-M0303-OP, p. 2481 - 2484 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| QC-4598 |
| carbonic acid 1-methyl-cyclopropyl ester 4-nitro-phenyl ester |
| carbonic acid 1-methyl-cyclopropyl 4-nitro-phenyl ester |
| 1-Methylcyclopropyl 4-nitrophenyl carbonate |