1-benzhydryl-4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enyl]piperazine,dihydrochloride structure
|
Common Name | 1-benzhydryl-4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enyl]piperazine,dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 104690-88-2 | Molecular Weight | 531.51400 | |
| Density | N/A | Boiling Point | 587.9ºC at 760mmHg | |
| Molecular Formula | C29H36Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.9ºC | |
| Name | 1-benzhydryl-4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enyl]piperazine,dihydrochloride |
|---|
| Boiling Point | 587.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C29H36Cl2N2O3 |
| Molecular Weight | 531.51400 |
| Flash Point | 155.9ºC |
| Exact Mass | 530.21000 |
| PSA | 34.17000 |
| LogP | 6.61260 |
| Vapour Pressure | 8.4E-14mmHg at 25°C |
| InChIKey | YCYUKHYPIZACDT-OVWKBUNZSA-N |
| SMILES | COc1ccc(C=CCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c(OC)c1OC.Cl.Cl |
|
~58%
1-benzhydryl-4-... CAS#:104690-88-2 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 35, # 10 p. 4124 - 4129 |
|
~%
1-benzhydryl-4-... CAS#:104690-88-2 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 35, # 10 p. 4124 - 4129 |
|
~%
1-benzhydryl-4-... CAS#:104690-88-2 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 35, # 10 p. 4124 - 4129 |
|
~%
1-benzhydryl-4-... CAS#:104690-88-2 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 35, # 10 p. 4124 - 4129 |
|
~19%
1-benzhydryl-4-... CAS#:104690-88-2 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 35, # 10 p. 4124 - 4129 |