(2R,3S,5S)-5-[2-(4-butylanilino)-6-chloropurin-9-yl]-2-(hydroxymethyl)oxolan-3-ol structure
|
Common Name | (2R,3S,5S)-5-[2-(4-butylanilino)-6-chloropurin-9-yl]-2-(hydroxymethyl)oxolan-3-ol | ||
|---|---|---|---|---|
| CAS Number | 104715-73-3 | Molecular Weight | 417.88900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24ClN5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R,3S,5S)-5-[2-(4-butylanilino)-6-chloropurin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|
| Molecular Formula | C20H24ClN5O3 |
|---|---|
| Molecular Weight | 417.88900 |
| Exact Mass | 417.15700 |
| PSA | 105.32000 |
| LogP | 3.27960 |
| InChIKey | FBRDWENSZCBQLS-XHSDSOJGSA-N |
| SMILES | CCCCc1ccc(Nc2nc(Cl)c3ncn(C4CC(O)C(CO)O4)c3n2)cc1 |
|
~%
(2R,3S,5S)-5-[2... CAS#:104715-73-3 |
| Literature: Wright, George E.; Dudycz, Lech W.; Kazimierczuk, Zygmunt; Brown, Neal C.; Khan, Naseema N. Journal of Medicinal Chemistry, 1987 , vol. 30, # 1 p. 109 - 116 |
|
~%
(2R,3S,5S)-5-[2... CAS#:104715-73-3 |
| Literature: Wright, George E.; Dudycz, Lech W.; Kazimierczuk, Zygmunt; Brown, Neal C.; Khan, Naseema N. Journal of Medicinal Chemistry, 1987 , vol. 30, # 1 p. 109 - 116 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |