tert-butyl (4-methylphenyl) carbonate structure
|
Common Name | tert-butyl (4-methylphenyl) carbonate | ||
|---|---|---|---|---|
| CAS Number | 104741-75-5 | Molecular Weight | 208.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl (4-methylphenyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.25400 |
| Exact Mass | 208.11000 |
| PSA | 35.53000 |
| LogP | 3.30890 |
| InChIKey | PFRYXDUSWPRWKQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(=O)OC(C)(C)C)cc1 |
|
~98%
tert-butyl (4-m... CAS#:104741-75-5 |
| Literature: Basel, Yochai; Hassner, Alfred Journal of Organic Chemistry, 2000 , vol. 65, # 20 p. 6368 - 6380 |
|
~%
tert-butyl (4-m... CAS#:104741-75-5 |
| Literature: McKay; Albertson Journal of the American Chemical Society, 1957 , vol. 79, p. 4686,4689 |
| Carbonic acid,1,1-dimethylethyl 4-methylphenyl ester |
| carbonic acid tert-butyl ester-p-tolyl ester |
| tert-butyl p-tolyl carbonate |
| 1-tert-butoxycarbonyloxy-4-methylbenzene |
| Kohlensaeure-tert-butylester-p-tolylester |
| tert-butyl 4-methylphenyl carbonate |