4-Methoxy-2,2'-Bipyrrole-5-Carboxaldehyde structure
|
Common Name | 4-Methoxy-2,2'-Bipyrrole-5-Carboxaldehyde | ||
|---|---|---|---|---|
| CAS Number | 10476-41-2 | Molecular Weight | 190.19900 | |
| Density | 1.293g/cm3 | Boiling Point | 462.3ºC at 760 mmHg | |
| Molecular Formula | C10H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.4ºC | |
| Name | 3-methoxy-5-(1H-pyrrol-2-yl)-1H-pyrrole-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 462.3ºC at 760 mmHg |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.19900 |
| Flash Point | 233.4ºC |
| Exact Mass | 190.07400 |
| PSA | 57.88000 |
| LogP | 1.83090 |
| Vapour Pressure | 9.96E-09mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | MQCYELLGZFKAFD-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2ccc[nH]2)[nH]c1C=O |
| Storage condition | 2-8°C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| CL4579 |
| 4-METHOXY-1H,1'H-2,2'-BIPYRROLE-5-CARBALDEHYDE |
| 4-Methoxy-2,2'-bipyrrole-5-carboxaldehyde |