Benzaldehyde,4-methyl-, 2-(4-nitrophenyl)hydrazone structure
|
Common Name | Benzaldehyde,4-methyl-, 2-(4-nitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 10477-83-5 | Molecular Weight | 255.27200 | |
| Density | 1.188g/cm3 | Boiling Point | 418.858ºC at 760 mmHg | |
| Molecular Formula | C14H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.118ºC | |
| Name | N-[(4-methylphenyl)methylideneamino]-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 418.858ºC at 760 mmHg |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.27200 |
| Flash Point | 207.118ºC |
| Exact Mass | 255.10100 |
| PSA | 70.21000 |
| LogP | 3.94540 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | ZOAAHAWFYOXJHZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C=NNc2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
Benzaldehyde,4-... CAS#:10477-83-5 |
| Literature: Hanzlik; Bianchi Chemische Berichte, 1899 , vol. 32, p. 1287 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-Methyl-benzaldehyd-(4-nitro-phenylhydrazon) |
| 1-(4-methylbenzylidene)-2-(4-nitrophenyl)hydrazine |
| p-Toluylaldehyd-(4-nitro-phenylhydrazon) |
| 4-methyl-benzaldehyde-(4-nitro-phenylhydrazone) |
| 4-methylbenzaldehyde N-(4-nitrophenyl)hydrazone |
| Benzaldehyde,4-methyl-,2-(4-nitrophenyl)hydrazone |