2,4,6-trichlorobenzenesulfonate structure
|
Common Name | 2,4,6-trichlorobenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 104778-51-0 | Molecular Weight | 260.50200 | |
| Density | 1.766g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H2Cl3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4,6-trichlorobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.766g/cm3 |
|---|---|
| Molecular Formula | C6H2Cl3O3S |
| Molecular Weight | 260.50200 |
| Exact Mass | 258.87900 |
| PSA | 65.58000 |
| LogP | 3.63170 |
| Index of Refraction | 1.613 |
| InChIKey | SJDXJURIQGALGO-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1c(Cl)cc(Cl)cc1Cl |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzenesulfonic acid,2,4,6-trichloro |
| 2,4,6-Trichlor-benzolsulfonsaeure |
| 2,4,6-trichloro-benzenesulfonic acid |