2-(9,10-dioxoanthracen-1-yl)oxyethyl 4-methylbenzenesulfonate structure
|
Common Name | 2-(9,10-dioxoanthracen-1-yl)oxyethyl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 104779-04-6 | Molecular Weight | 422.45000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H18O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(9,10-dioxoanthracen-1-yl)oxyethyl 4-methylbenzenesulfonate |
|---|
| Molecular Formula | C23H18O6S |
|---|---|
| Molecular Weight | 422.45000 |
| Exact Mass | 422.08200 |
| PSA | 95.12000 |
| LogP | 4.63550 |
| InChIKey | JQBNLMAJSWIYGD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
|
~71%
2-(9,10-dioxoan... CAS#:104779-04-6 |
| Literature: Journal of the American Chemical Society, , vol. 108, # 24 p. 7553 - 7560 |
|
~%
2-(9,10-dioxoan... CAS#:104779-04-6 |
| Literature: Gustowski, Deborah A.; Delgado, Milargos; Gatto, Vincent J.; Echegoyen, Luis; Gokel, George W. Journal of the American Chemical Society, 1986 , vol. 108, # 24 p. 7553 - 7560 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |