pentyl 3,5-dinitrobenzoate structure
|
Common Name | pentyl 3,5-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 10478-03-2 | Molecular Weight | 282.24900 | |
| Density | 1.3g/cm3 | Boiling Point | 401.7ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.5ºC | |
| Name | pentyl 3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 401.7ºC at 760 mmHg |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.24900 |
| Flash Point | 169.5ºC |
| Exact Mass | 282.08500 |
| PSA | 117.94000 |
| LogP | 3.89640 |
| Vapour Pressure | 1.16E-06mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | KVRKVNNGYVWNGH-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| HS Code | 2916399090 |
|---|
|
~67%
pentyl 3,5-dini... CAS#:10478-03-2 |
| Literature: Liu, Jun; Shao, Changdong; Zhang, Yanghui; Shi, Guangfa; Pan, Shulei Organic and Biomolecular Chemistry, 2014 , vol. 12, # 17 p. 2637 - 2640 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3.5-Dinitro-benzoesaeure-n-amylester |
| Benzoic acid,3,5-dinitro-,pentyl ester |
| 3,5-Dinitro-benzoesaeure-pentylester |
| 3,5-dinitro-benzoic acid pentyl ester |
| 1-<3.5-Dinitro-benzoyloxy>-pentan |