2,3-Furandicarboxylicacid, 4,5-diphenyl-, 2,3-dimethyl ester structure
|
Common Name | 2,3-Furandicarboxylicacid, 4,5-diphenyl-, 2,3-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1048-83-5 | Molecular Weight | 336.33800 | |
| Density | 1.207g/cm3 | Boiling Point | 475.4ºC at 760 mmHg | |
| Molecular Formula | C20H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.3ºC | |
| Name | dimethyl 4,5-diphenylfuran-2,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 475.4ºC at 760 mmHg |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.33800 |
| Flash Point | 241.3ºC |
| Exact Mass | 336.10000 |
| PSA | 65.74000 |
| LogP | 4.18680 |
| Vapour Pressure | 3.34E-09mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | CTBVWDJDPUAGQX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1oc(-c2ccccc2)c(-c2ccccc2)c1C(=O)OC |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4,5-Diphenyl-furan-dicarbonsaeure-dimethylester-(2,3) |
| 4,5-diphenyl-furan-2,3-dicarboxylic acid dimethyl ester |