1H-1,2,3-Triazole,4,5-dihydro-1-(4-nitrophenyl)-5-phenyl- structure
|
Common Name | 1H-1,2,3-Triazole,4,5-dihydro-1-(4-nitrophenyl)-5-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 10480-11-2 | Molecular Weight | 268.27100 | |
| Density | 1.35g/cm3 | Boiling Point | 443.5ºC at 760mmHg | |
| Molecular Formula | C14H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222ºC | |
| Name | 1-(4-nitrophenyl)-5-phenyl-4,5-dihydrotriazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 443.5ºC at 760mmHg |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.27100 |
| Flash Point | 222ºC |
| Exact Mass | 268.09600 |
| PSA | 73.78000 |
| LogP | 2.98270 |
| Vapour Pressure | 4.63E-08mmHg at 25°C |
| Index of Refraction | 1.683 |
| InChIKey | PUWUPGKGBRTMOT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2N=NCC2c2ccccc2)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
1H-1,2,3-Triazo... CAS#:10480-11-2 |
| Literature: Kadaba, Pankaja K. Pesticide Science, 1994 , vol. 42, # 4 p. 299 - 304 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-nitrophenyl)-5-phenyl-4,5-dihydro-1h-1,2,3-triazole |
| 5-Phenyl-1-(4-nitro-phenyl)-1,2,3-triazolin |