6-amino-7-methyl-1H-purine-2-thione
6-amino-7-methyl-1H-purine-2-thione structure
|
Common Name | 6-amino-7-methyl-1H-purine-2-thione | ||
|---|---|---|---|---|
| CAS Number | 104802-77-9 | Molecular Weight | 181.21800 | |
| Density | 1.78g/cm3 | Boiling Point | 271.6ºC at 760mmHg | |
| Molecular Formula | C6H7N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-amino-7-methyl-1H-purine-2-thione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.78g/cm3 |
|---|---|
| Boiling Point | 271.6ºC at 760mmHg |
| Molecular Formula | C6H7N5S |
| Molecular Weight | 181.21800 |
| Flash Point | 118.1ºC |
| Exact Mass | 181.04200 |
| PSA | 108.42000 |
| LogP | 0.81540 |
| Vapour Pressure | 0.00637mmHg at 25°C |
| Index of Refraction | 1.9 |
| InChIKey | PHARJWGRHPDCIU-UHFFFAOYSA-N |
| SMILES | Cn1cnc2nc(=S)[nH]c(N)c21 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-amino-7-methy... CAS#:104802-77-9 |
| Literature: Muravich-Aleksandr, Kh. L.; Pernikoza, V. G.; Ragozina, T. N. Journal of Organic Chemistry USSR (English Translation), 1987 , vol. 23, # 4 p. 767 - 775 Zhurnal Organicheskoi Khimii, 1987 , vol. 23, # 4 p. 848 - 858 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2H-Purine-2-thione,1,7-dihydro-6-amino-7-methyl |
| 2-thio-6-amino-7-methylpurine |
| 2-Thio-7-methyladenine |
| 1,7-Dihydro-6-amino-7-methyl-2H-purine-2-thione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 6-amino-7-methyl-1H-purine-2-thione? |
| A: CAS number of 6-amino-7-methyl-1H-purine-2-thione is 104802-77-9. |
| Q: What is the SMILES notation of 6-amino-7-methyl-1H-purine-2-thione? |
| A: SMILES notation of 6-amino-7-methyl-1H-purine-2-thione is Cn1cnc2nc(=S)[nH]c(N)c21. |
| Q: What is the LogP of 6-amino-7-methyl-1H-purine-2-thione? |
| A: LogP of 6-amino-7-methyl-1H-purine-2-thione is 0.81540. |
| Q: What is the polar surface area (PSA) of 6-amino-7-methyl-1H-purine-2-thione? |
| A: Polar surface area (PSA) of 6-amino-7-methyl-1H-purine-2-thione is 108.42000. |
| Q: What is the molecular weight of 6-amino-7-methyl-1H-purine-2-thione? |
| A: Molecular weight of 6-amino-7-methyl-1H-purine-2-thione is 181.21800. |
| Q: What is the boiling point of 6-amino-7-methyl-1H-purine-2-thione? |
| A: Boiling point of 6-amino-7-methyl-1H-purine-2-thione is 271.6ºC at 760mmHg. |
| Q: What English synonyms does 6-amino-7-methyl-1H-purine-2-thione have? |
| A: English synonyms of 6-amino-7-methyl-1H-purine-2-thione: 2H-Purine-2-thione,1,7-dihydro-6-amino-7-methyl, 2-thio-6-amino-7-methylpurine, 2-Thio-7-methyladenine, 1,7-Dihydro-6-amino-7-methyl-2H-purine-2-thione. |
| Q: What is the English name of 6-amino-7-methyl-1H-purine-2-thione? |
| A: The English name of 6-amino-7-methyl-1H-purine-2-thione is 6-amino-7-methyl-1H-purine-2-thione. |
| Q: What is the Chinese name of 104802-77-9? |
| A: Chinese name of 104802-77-9 is 104802-77-9. |
| Q: What is the molecular formula of 6-amino-7-methyl-1H-purine-2-thione? |
| A: Molecular formula of 6-amino-7-methyl-1H-purine-2-thione is C6H7N5S. |