2-Nitrophenyl octanoate
Modify Date: 2025-10-01 06:00:17
2-Nitrophenyl octanoate structure
|
Common Name | 2-Nitrophenyl octanoate | ||
|---|---|---|---|---|
| CAS Number | 104809-25-8 | Molecular Weight | 265.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-nitrophenyl) octanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H19NO4 |
|---|---|
| Molecular Weight | 265.30500 |
| Exact Mass | 265.13100 |
| PSA | 72.12000 |
| LogP | 4.38390 |
| InChIKey | JVGMTJWLAKQHRL-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)Oc1ccccc1[N+](=O)[O-] |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Caprylsaeure-(2-nitro-phenylester) |
| Caprylic acid o-nitrophenyl ester |
| 2-Nitrophenyl octanoate |