3-(2-amino-1,3-thiazol-4-yl)-2-methylchromen-4-one structure
|
Common Name | 3-(2-amino-1,3-thiazol-4-yl)-2-methylchromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 104819-35-4 | Molecular Weight | 258.29600 | |
| Density | 1.417g/cm3 | Boiling Point | 466.4ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.9ºC | |
| Name | 3-(2-amino-1,3-thiazol-4-yl)-2-methylchromen-4-one |
|---|
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 466.4ºC at 760 mmHg |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.29600 |
| Flash Point | 235.9ºC |
| Exact Mass | 258.04600 |
| PSA | 98.09000 |
| LogP | 2.73720 |
| Vapour Pressure | 7.11E-09mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | JPZBTZITNDQIMR-UHFFFAOYSA-N |
| SMILES | Cc1oc2ccccc2c(=O)c1-c1csc(N)n1 |
|
~60%
3-(2-amino-1,3-... CAS#:104819-35-4 |
| Literature: Garg, C. P.; Sharma, Vinay Prabha; Kapoor, R. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 1197 - 1200 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |