6-chloro-2-methyl-3-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)chromen-4-one structure
|
Common Name | 6-chloro-2-methyl-3-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 104819-37-6 | Molecular Weight | 392.85800 | |
| Density | 1.45g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H13ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-2-methyl-3-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)chromen-4-one |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Molecular Formula | C21H13ClN2O2S |
| Molecular Weight | 392.85800 |
| Exact Mass | 392.03900 |
| PSA | 75.75000 |
| LogP | 5.79800 |
| Index of Refraction | 1.731 |
| InChIKey | OGFCWEKDPGAFHW-UHFFFAOYSA-N |
| SMILES | Cc1oc2ccc(Cl)cc2c(=O)c1-c1csc2nc(-c3ccccc3)cn12 |
|
~58%
6-chloro-2-meth... CAS#:104819-37-6 |
| Literature: Garg, C. P.; Sharma, Vinay Prabha; Kapoor, R. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 1197 - 1200 |
|
~%
6-chloro-2-meth... CAS#:104819-37-6 |
| Literature: Garg, C. P.; Sharma, Vinay Prabha; Kapoor, R. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 1197 - 1200 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |