citronellyl benzoate structure
|
Common Name | citronellyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 10482-77-6 | Molecular Weight | 260.37100 | |
| Density | 0.965g/cm3 | Boiling Point | 357.7ºC at 760 mmHg | |
| Molecular Formula | C17H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.8ºC | |
| Name | 3,7-dimethyloct-6-enyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.965g/cm3 |
|---|---|
| Boiling Point | 357.7ºC at 760 mmHg |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.37100 |
| Flash Point | 162.8ºC |
| Exact Mass | 260.17800 |
| PSA | 26.30000 |
| LogP | 4.61600 |
| Vapour Pressure | 2.68E-05mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | UDPCCAUIDDVTEL-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC(C)CCOC(=O)c1ccccc1 |
| HS Code | 2916310090 |
|---|
|
~88%
citronellyl benzoate CAS#:10482-77-6 |
| Literature: Kapat, Ajoy; Koenig, Andreas; Montermini, Florian; Renaud, Philippe Journal of the American Chemical Society, 2011 , vol. 133, # 35 p. 13890 - 13893 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Benzoesaeure-citronellylester |
| EINECS 233-988-9 |
| 6-Octen-1-ol,3,7-dimethyl-,benzoate |
| 1-benzoyl citronellol |
| Benzoesaeure-(3,7-dimethyl-oct-6-enylester) |
| 6-Octen-1-ol,3,7-dimethyl-,1-benzoate |
| Citronellylbenzoat |
| benzoic acid-(3,7-dimethyl-oct-6-enyl ester) |
| citronellyl benzoate |