Germanicol acetate structure
|
Common Name | Germanicol acetate | ||
|---|---|---|---|---|
| CAS Number | 10483-91-7 | Molecular Weight | 468.75 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H52O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Germanicol acetateGermanicol acetate can be extracted from Euphorbia heterophylla L. and has phytotoxic activity[1]. |
| Name | [(3S,6aR,6aR,6bR,8aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicen-3-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Germanicol acetate can be extracted from Euphorbia heterophylla L. and has phytotoxic activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C32H52O2 |
|---|---|
| Molecular Weight | 468.75 |
| Exact Mass | 470.41200 |
| PSA | 26.30000 |
| LogP | 8.81960 |
| InChIKey | FKMDSFSBFAGDCK-SPFANWNTSA-N |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4=CC(C)(C)CCC4(C)CCC23C)C1(C)C |
| germanicol acetate |
| germanicol-3-O-acetate |
| Germanicyl acetate |
| isolupeol acetate |
| germanicol-3-acetate |