Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate
Modify Date: 2026-09-21 17:45:44
Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate structure
|
Common Name | Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate | ||
|---|---|---|---|---|
| CAS Number | 104830-10-6 | Molecular Weight | 284.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14BrNO2 |
|---|---|
| Molecular Weight | 284.15 |
| InChIKey | SQUKIGKVVXRYCY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=Cc1c(C)cc(C)nc1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 104830-10-6? |
| A: Chinese name of 104830-10-6 is 104830-10-6. |
| Q: What is the InChIKey of Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate? |
| A: InChIKey of Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate is SQUKIGKVVXRYCY-UHFFFAOYSA-N. |
| Q: What is the English name of Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate? |
| A: The English name of Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate is Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate. |
| Q: What is the SMILES notation of Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate? |
| A: SMILES notation of Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate is CCOC(=O)C=Cc1c(C)cc(C)nc1Br. |
| Q: What is the CAS number of Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate? |
| A: CAS number of Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate is 104830-10-6. |
| Q: What is the molecular weight of Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate? |
| A: Molecular weight of Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate is 284.15. |
| Q: What is the molecular formula of Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate? |
| A: Molecular formula of Ethyl 3-(2-bromo-4,6-dimethyl-3-pyridinyl)-2-propenoate is C12H14BrNO2. |