5-[9-(2,3-dihydroxyphenyl)nonyl]-3-methylideneoxolan-2-one structure
|
Common Name | 5-[9-(2,3-dihydroxyphenyl)nonyl]-3-methylideneoxolan-2-one | ||
|---|---|---|---|---|
| CAS Number | 104876-09-7 | Molecular Weight | 332.43400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[9-(2,3-dihydroxyphenyl)nonyl]-3-methylideneoxolan-2-one |
|---|
| Molecular Formula | C20H28O4 |
|---|---|
| Molecular Weight | 332.43400 |
| Exact Mass | 332.19900 |
| PSA | 66.76000 |
| LogP | 4.63280 |
| InChIKey | SKCQGHHJJUEPFL-UHFFFAOYSA-N |
| SMILES | C=C1CC(CCCCCCCCCc2cccc(O)c2O)OC1=O |
|
~%
5-[9-(2,3-dihyd... CAS#:104876-09-7 |
| Literature: Mattes, Henri; Benezra, Claude Journal of Medicinal Chemistry, 1987 , vol. 30, # 1 p. 165 - 168 |
|
~%
5-[9-(2,3-dihyd... CAS#:104876-09-7 |
| Literature: Mattes, Henri; Benezra, Claude Journal of Medicinal Chemistry, 1987 , vol. 30, # 1 p. 165 - 168 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |