2-((tert-butoxycarbonyl)amino)-3-(naphthalen-1-yl)propanoic acid structure
|
Common Name | 2-((tert-butoxycarbonyl)amino)-3-(naphthalen-1-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 104882-22-6 | Molecular Weight | 315.36400 | |
| Density | 1.2g/cm3 | Boiling Point | 512.2ºC at 760 mmHg | |
| Molecular Formula | C18H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.6ºC | |
| Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-naphthalen-1-ylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 512.2ºC at 760 mmHg |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.36400 |
| Flash Point | 263.6ºC |
| Exact Mass | 315.14700 |
| PSA | 75.63000 |
| LogP | 3.75110 |
| Vapour Pressure | 2.58E-11mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | KHHIGWRTNILXLL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cccc2ccccc12)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-L-1-naphthylalanine |
| 2-tert-Butoxycarbonylamino-3-naphthalen-1-yl-propionic acid |
| L-N-Boc-1-naphthyl-Ala-OH |